What is the name of the document in which an entrepreneur summarizes his or her business strategy for a proposed new venture?

Use your calculator to solve each equation. Express each answer in proper scientific notation and with the proper number of significant figures. (7.8 x 105) x (3.42 x 10-3) = [Faye10] (2.997 x 108) / (1.58 x 1020) = [Faye11] 875.3 / (5.390 x 102) = [Faye12]

Aluminum has three valence electrons. How will it most likely achieve an octet of electrons?      

Which element would be similar to sodium in chemical characteristics? Answer Yes for similar and No for not similar. Mg  [Sam1] Cr  [Sam2] S  [Sam3] B  [Sam4] Rb  [Sam5]

How would a chemist categorize each example of matter? Choose between Pure Substance and Mixture. Coffee  [fay1] Hydrogen  [fay2] An egg  [fay3]

How many electrons are present in the atoms of each neutral element? Magnesium  [Joe4] Potassium  [Joe5] Iodine  [Joe6]

Which of the following compounds have a molecular formula of C2H6O?    a. I b. II c. III d. IV e. Both I & III

Which of the following compounds contain a ketone functional group?    a. one b. two c. three d. four e. All of these

How many hydrogen atoms are connected to the indicated carbon atom?    a. one b. two c. three d. four e. none

Which of the following is the correct condensed structure for the following compound? a. CH3C(CH3)2(CH2)2(CH)BrC(CH3)2 b. CH3CH3CH3C(CH2)2C(CH3)2CHBr c. (CH3)3C(CH2)3BrCHCH3CH3 d. CH3CH3CH3C(CH2)2CHBrCHCH3CH3 e.  (CH3)3C(CH2)2CHBrCH(CH3)2