How many electrons are present in the atoms of each neutral element? Magnesium  [Joe4] Potassium  [Joe5] Iodine  [Joe6]

Which of the following compounds have a molecular formula of C2H6O?    a. I b. II c. III d. IV e. Both I & III

Which of the following compounds contain a ketone functional group?    a. one b. two c. three d. four e. All of these

How many hydrogen atoms are connected to the indicated carbon atom?    a. one b. two c. three d. four e. none

Which of the following is the correct condensed structure for the following compound? a. CH3C(CH3)2(CH2)2(CH)BrC(CH3)2 b. CH3CH3CH3C(CH2)2C(CH3)2CHBr c. (CH3)3C(CH2)3BrCHCH3CH3 d. CH3CH3CH3C(CH2)2CHBrCHCH3CH3 e.  (CH3)3C(CH2)2CHBrCH(CH3)2

All single bonds can be classified as:   a. nonpolar covalent b. polar covalent c. ionic d. sigma bonds  e.

The five men appointed by Second Continental Congress in 1776 to write a statement about American independence from British rule were Robert Livingston, John Adams, Benjamin Franklin, Roger Sherman, and

Which of the following compounds is most acidic?    a. I b. II c. III d. IV e. None of these

What is the formal charge on the oxygen atom in the following compound?    a. +1 b. +2 c. -1 d. -2 e. 0

Which of the following pairs are resonance structures of each other?    a. I b. II c. III d. IV e. None of these